C19H21N5O2 — CID 11450989
4-(cyclohexen-1-yl)-N-(1H-indazol-5-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 11450989) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-(cyclohexen-1-yl)-N-(1H-indazol-5-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 4-(cyclohexen-1-yl)-N-(1H-indazol-5-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11450989 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 4-(cyclohexen-1-yl)-N-(1H-indazol-5-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc3[nH]ncc3c2)C(C2=CCCCC2)NC(=O)N1 |
| InChI | InChI=1S/C19H21N5O2/c1-11-16(17(23-19(26)21-11)12-5-3-2-4-6-12)18(25)22-14-7-8-15-13(9-14)10-20-24-15/h5,7-10,17H,2-4,6H2,1H3,(H,20,24)(H,22,25)(H2,21,23,26) |
| InChIKey | HQMQPFVZCQJKBI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|