C19H32N2O4 — CID 11451020
(2R,3R,6R)-2,3,6-trimethyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione (PubChem CID 11451020) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is (2R,3R,6R)-2,3,6-trimethyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione.
| Compound Name | (2R,3R,6R)-2,3,6-trimethyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione |
|---|---|
| PubChem CID | 11451020 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (2R,3R,6R)-2,3,6-trimethyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione |
| SMILES | C=C(C[C@@H](C)C(=O)N1CCOCC1)[C@H](C)[C@@H](C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H32N2O4/c1-14(13-15(2)18(22)20-5-9-24-10-6-20)16(3)17(4)19(23)21-7-11-25-12-8-21/h15-17H,1,5-13H2,2-4H3/t15-,16+,17-/m1/s1 |
| InChIKey | KMIFZDDXHUWFCF-IXDOHACOSA-N |
| XLogP | 1.56 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|