C14H25N3O — CID 114510495
3-ethyl-4-[(2-ethyl-5-methylpyrazol-3-yl)methyl]piperidin-4-ol (PubChem CID 114510495) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-ethyl-4-[(2-ethyl-5-methylpyrazol-3-yl)methyl]piperidin-4-ol.
| Compound Name | 3-ethyl-4-[(2-ethyl-5-methylpyrazol-3-yl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 114510495 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 3-ethyl-4-[(2-ethyl-5-methylpyrazol-3-yl)methyl]piperidin-4-ol |
| SMILES | CCC1CNCCC1(O)Cc1cc(C)nn1CC |
| InChI | InChI=1S/C14H25N3O/c1-4-12-10-15-7-6-14(12,18)9-13-8-11(3)16-17(13)5-2/h8,12,15,18H,4-7,9-10H2,1-3H3 |
| InChIKey | JAKUWWJXTCIEAP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |