C12H18BrNOS — CID 114510889
1-[(4-bromothiophen-2-yl)methyl]-3-ethylpiperidin-4-ol (PubChem CID 114510889) has the molecular formula C12H18BrNOS and a molecular weight of 304.25 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-3-ethylpiperidin-4-ol.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-3-ethylpiperidin-4-ol |
|---|---|
| PubChem CID | 114510889 |
| Molecular Formula | C12H18BrNOS |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-3-ethylpiperidin-4-ol |
| SMILES | CCC1CN(Cc2cc(Br)cs2)CCC1O |
| InChI | InChI=1S/C12H18BrNOS/c1-2-9-6-14(4-3-12(9)15)7-11-5-10(13)8-16-11/h5,8-9,12,15H,2-4,6-7H2,1H3 |
| InChIKey | XOZKUMAXJDDGQR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |