C15H27NO3 — CID 114511258
2-[butyl(ethyl)carbamoyl]-4-ethylcyclopentane-1-carboxylic acid (PubChem CID 114511258) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is 2-[butyl(ethyl)carbamoyl]-4-ethylcyclopentane-1-carboxylic acid.
| Compound Name | 2-[butyl(ethyl)carbamoyl]-4-ethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114511258 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 2-[butyl(ethyl)carbamoyl]-4-ethylcyclopentane-1-carboxylic acid |
| SMILES | CCCCN(CC)C(=O)C1CC(CC)CC1C(=O)O |
| InChI | InChI=1S/C15H27NO3/c1-4-7-8-16(6-3)14(17)12-9-11(5-2)10-13(12)15(18)19/h11-13H,4-10H2,1-3H3,(H,18,19) |
| InChIKey | QRKPKMQOVPKQHQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |