C15H27N5O5 — CID 11451168
(1S,3R,4S)-3-[(1R)-1-acetamido-2-(diethylamino)-2-oxoethyl]-4-(diaminomethylideneamino)-1-hydroxycyclopentane-1-carboxylic acid (PubChem CID 11451168) has the molecular formula C15H27N5O5 and a molecular weight of 357.41 g/mol. Its IUPAC name is (1S,3R,4S)-3-[(1R)-1-acetamido-2-(diethylamino)-2-oxoethyl]-4-(diaminomethylideneamino)-1-hydroxycyclopentane-1-carboxylic acid.
| Compound Name | (1S,3R,4S)-3-[(1R)-1-acetamido-2-(diethylamino)-2-oxoethyl]-4-(diaminomethylideneamino)-1-hydroxycyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 11451168 |
| Molecular Formula | C15H27N5O5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | (1S,3R,4S)-3-[(1R)-1-acetamido-2-(diethylamino)-2-oxoethyl]-4-(diaminomethylideneamino)-1-hydroxycyclopentane-1-carboxylic acid |
| SMILES | CCN(CC)C(=O)[C@H](NC(C)=O)[C@H]1C[C@@](O)(C(=O)O)C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C15H27N5O5/c1-4-20(5-2)12(22)11(18-8(3)21)9-6-15(25,13(23)24)7-10(9)19-14(16)17/h9-11,25H,4-7H2,1-3H3,(H,18,21)(H,23,24)(H4,16,17,19)/t9-,10-,11+,15-/m0/s1 |
| InChIKey | SLTJBSDIFKVLCP-ZVXAKGHKSA-N |
| XLogP | -1.77 |
| TPSA | 171.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|