About 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid
4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 114511706) has the molecular formula C14H20N2O3S
and a molecular weight of 296.39 g/mol. Its IUPAC name is 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid |
| PubChem CID | 114511706 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | CCC1CC(C(=O)O)C(C(=O)N(C)Cc2cscn2)C1 |
| InChI | InChI=1S/C14H20N2O3S/c1-3-9-4-11(12(5-9)14(18)19)13(17)16(2)6-10-7-20-8-15-10/h7-9,11-12H,3-6H2,1-2H3,(H,18,19) |
| InChIKey | WMLAZMZRZZHDCH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid?
The IUPAC name of 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid (CID 114511706) is 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid.
What is the SMILES notation for 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid?
The canonical SMILES for 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid is CCC1CC(C(=O)O)C(C(=O)N(C)Cc2cscn2)C1.
What is the InChIKey of 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid?
The InChIKey is WMLAZMZRZZHDCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3S/c1-3-9-4-11(12(5-9)14(18)19)13(17)16(2)6-10-7-20-8-15-10/h7-9,11-12H,3-6H2,1-2H3,(H,18,19).
What are the key properties of 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid?
4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid has a molecular weight of 296.39 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 114511706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).