C20H38O5 — CID 11451204
(Z,2R,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1-ethoxyethoxy)undec-5-en-2-ol (PubChem CID 11451204) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is (Z,2R,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1-ethoxyethoxy)undec-5-en-2-ol.
| Compound Name | (Z,2R,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1-ethoxyethoxy)undec-5-en-2-ol |
|---|---|
| PubChem CID | 11451204 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (Z,2R,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1-ethoxyethoxy)undec-5-en-2-ol |
| SMILES | CCOC(C)O[C@@H](C/C=C\CCC[C@H](C)[C@@H]1COC(C)(C)O1)[C@@H](C)O |
| InChI | InChI=1S/C20H38O5/c1-7-22-17(4)24-18(16(3)21)13-11-9-8-10-12-15(2)19-14-23-20(5,6)25-19/h9,11,15-19,21H,7-8,10,12-14H2,1-6H3/b11-9-/t15-,16+,17?,18-,19-/m0/s1 |
| InChIKey | VOBURVHHRNKBLF-QYQDYALUSA-N |
| XLogP | 4.04 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|