About 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione
1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione (PubChem CID 11451215) has the molecular formula C18H21N3O5
and a molecular weight of 359.38 g/mol. Its IUPAC name is 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione.
Molecular Properties
| Compound Name | 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione |
| PubChem CID | 11451215 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione |
| SMILES | CCCc1nn(C)c(C(=O)CC(=O)c2c(C)cc(C)cc2O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N3O5/c1-5-6-12-17(21(25)26)18(20(4)19-12)15(24)9-14(23)16-11(3)7-10(2)8-13(16)22/h7-8,22H,5-6,9H2,1-4H3 |
| InChIKey | NDQSCRCFPWPUGQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione?
The IUPAC name of 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione (CID 11451215) is 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione.
What is the SMILES notation for 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione?
The canonical SMILES for 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione is CCCc1nn(C)c(C(=O)CC(=O)c2c(C)cc(C)cc2O)c1[N+](=O)[O-].
What is the InChIKey of 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione?
The InChIKey is NDQSCRCFPWPUGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O5/c1-5-6-12-17(21(25)26)18(20(4)19-12)15(24)9-14(23)16-11(3)7-10(2)8-13(16)22/h7-8,22H,5-6,9H2,1-4H3.
What are the key properties of 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione?
1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione has a molecular weight of 359.38 g/mol, XLogP of 3.06, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxy-4,6-dimethylphenyl)-3-(1-methyl-4-nitro-3-propylpyrazol-5-yl)propane-1,3-dione is sourced from PubChem (CID 11451215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).