C15H18N2O3 — CID 114512471
4-ethyl-2-(6-hydroxy-1H-benzimidazol-2-yl)cyclopentane-1-carboxylic acid (PubChem CID 114512471) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-ethyl-2-(6-hydroxy-1H-benzimidazol-2-yl)cyclopentane-1-carboxylic acid.
| Compound Name | 4-ethyl-2-(6-hydroxy-1H-benzimidazol-2-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114512471 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-ethyl-2-(6-hydroxy-1H-benzimidazol-2-yl)cyclopentane-1-carboxylic acid |
| SMILES | CCC1CC(C(=O)O)C(c2nc3ccc(O)cc3[nH]2)C1 |
| InChI | InChI=1S/C15H18N2O3/c1-2-8-5-10(11(6-8)15(19)20)14-16-12-4-3-9(18)7-13(12)17-14/h3-4,7-8,10-11,18H,2,5-6H2,1H3,(H,16,17)(H,19,20) |
| InChIKey | HLNQNHNFXHPWCB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |