C25H28O2 — CID 11451258
(1R,5S,7R)-7-(4-methoxyphenyl)-1-[(E)-5-phenylpent-4-enyl]bicyclo[3.1.1]heptan-6-one (PubChem CID 11451258) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (1R,5S,7R)-7-(4-methoxyphenyl)-1-[(E)-5-phenylpent-4-enyl]bicyclo[3.1.1]heptan-6-one.
| Compound Name | (1R,5S,7R)-7-(4-methoxyphenyl)-1-[(E)-5-phenylpent-4-enyl]bicyclo[3.1.1]heptan-6-one |
|---|---|
| PubChem CID | 11451258 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (1R,5S,7R)-7-(4-methoxyphenyl)-1-[(E)-5-phenylpent-4-enyl]bicyclo[3.1.1]heptan-6-one |
| SMILES | COc1ccc([C@H]2[C@@H]3CCC[C@@]2(CCC/C=C/c2ccccc2)C3=O)cc1 |
| InChI | InChI=1S/C25H28O2/c1-27-21-15-13-20(14-16-21)23-22-12-8-18-25(23,24(22)26)17-7-3-6-11-19-9-4-2-5-10-19/h2,4-6,9-11,13-16,22-23H,3,7-8,12,17-18H2,1H3/b11-6+/t22-,23-,25+/m0/s1 |
| InChIKey | TWJIOWWLQZXPNY-QLGBKPRRSA-N |
| XLogP | 6.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|