C15H16BrNO2 — CID 114512682
2-(3-bromophenyl)-5-ethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 114512682) has the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. Its IUPAC name is 2-(3-bromophenyl)-5-ethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 2-(3-bromophenyl)-5-ethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 114512682 |
| Molecular Formula | C15H16BrNO2 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-(3-bromophenyl)-5-ethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | CCC1CC2C(=O)N(c3cccc(Br)c3)C(=O)C2C1 |
| InChI | InChI=1S/C15H16BrNO2/c1-2-9-6-12-13(7-9)15(19)17(14(12)18)11-5-3-4-10(16)8-11/h3-5,8-9,12-13H,2,6-7H2,1H3 |
| InChIKey | GRZZFMPNIXIBPN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|