C10H14BrNO2 — CID 114512941
2-(2-bromoethyl)-5-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 114512941) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 2-(2-bromoethyl)-5-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 2-(2-bromoethyl)-5-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 114512941 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-(2-bromoethyl)-5-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | CC1CC2C(=O)N(CCBr)C(=O)C2C1 |
| InChI | InChI=1S/C10H14BrNO2/c1-6-4-7-8(5-6)10(14)12(3-2-11)9(7)13/h6-8H,2-5H2,1H3 |
| InChIKey | ATILNHNCYVGCDC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|