C9H12BF3NO2- — CID 114514035
trifluoro-[(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]boranuide (PubChem CID 114514035) has the molecular formula C9H12BF3NO2- and a molecular weight of 234.01 g/mol. Its IUPAC name is trifluoro-[(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]boranuide.
| Compound Name | trifluoro-[(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]boranuide |
|---|---|
| PubChem CID | 114514035 |
| Molecular Formula | C9H12BF3NO2- |
| Molecular Weight | 234.01 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | trifluoro-[(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]boranuide |
| SMILES | CC1CC2C(=O)N(C[B-](F)(F)F)C(=O)C2C1 |
| InChI | InChI=1S/C9H12BF3NO2/c1-5-2-6-7(3-5)9(16)14(8(6)15)4-10(11,12)13/h5-7H,2-4H2,1H3/q-1 |
| InChIKey | HTZFEHALQYHGOW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.01 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|