About 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one
3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 114514470) has the molecular formula C8H8IN3O
and a molecular weight of 289.08 g/mol. Its IUPAC name is 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 114514470 |
| Molecular Formula | C8H8IN3O |
| Molecular Weight | 289.08 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n2[nH]c(C)c(I)c2n1 |
| InChI | InChI=1S/C8H8IN3O/c1-4-3-6(13)12-8(10-4)7(9)5(2)11-12/h3,11H,1-2H3 |
| InChIKey | ZYCVSTSSPYADPG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.08 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 114514470) is 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is Cc1cc(=O)n2[nH]c(C)c(I)c2n1.
What is the InChIKey of 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is ZYCVSTSSPYADPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8IN3O/c1-4-3-6(13)12-8(10-4)7(9)5(2)11-12/h3,11H,1-2H3.
What are the key properties of 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 289.08 g/mol, XLogP of 1.24, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2,5-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 114514470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).