C22H28N2O3 — CID 11451484
(1S,5R,7R)-10,10-dimethyl-3-phenyl-4-[(2R,3S)-3-propan-2-yloxirane-2-carbonyl]-3,4-diazatricyclo[5.2.1.01,5]decan-2-one (PubChem CID 11451484) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is (1S,5R,7R)-10,10-dimethyl-3-phenyl-4-[(2R,3S)-3-propan-2-yloxirane-2-carbonyl]-3,4-diazatricyclo[5.2.1.01,5]decan-2-one.
| Compound Name | (1S,5R,7R)-10,10-dimethyl-3-phenyl-4-[(2R,3S)-3-propan-2-yloxirane-2-carbonyl]-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
|---|---|
| PubChem CID | 11451484 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (1S,5R,7R)-10,10-dimethyl-3-phenyl-4-[(2R,3S)-3-propan-2-yloxirane-2-carbonyl]-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
| SMILES | CC(C)[C@@H]1O[C@H]1C(=O)N1[C@@H]2C[C@H]3CC[C@]2(C(=O)N1c1ccccc1)C3(C)C |
| InChI | InChI=1S/C22H28N2O3/c1-13(2)17-18(27-17)19(25)24-16-12-14-10-11-22(16,21(14,3)4)20(26)23(24)15-8-6-5-7-9-15/h5-9,13-14,16-18H,10-12H2,1-4H3/t14-,16-,17+,18-,22+/m1/s1 |
| InChIKey | GPQCCZGWKHFFKV-ZEENSLDLSA-N |
| XLogP | 3.40 |
| TPSA | 53.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|