C16H25N3O2 — CID 114514863
3-amino-2-methoxy-N-[2-(1-methylpiperidin-4-yl)ethyl]benzamide (PubChem CID 114514863) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-amino-2-methoxy-N-[2-(1-methylpiperidin-4-yl)ethyl]benzamide.
| Compound Name | 3-amino-2-methoxy-N-[2-(1-methylpiperidin-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 114514863 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 3-amino-2-methoxy-N-[2-(1-methylpiperidin-4-yl)ethyl]benzamide |
| SMILES | COc1c(N)cccc1C(=O)NCCC1CCN(C)CC1 |
| InChI | InChI=1S/C16H25N3O2/c1-19-10-7-12(8-11-19)6-9-18-16(20)13-4-3-5-14(17)15(13)21-2/h3-5,12H,6-11,17H2,1-2H3,(H,18,20) |
| InChIKey | PYELFUHAVWJMLM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|