C21H40O3Si — CID 11451492
3-[(2R,4R,5R)-4-methyl-5-[(E)-4-tri(propan-2-yl)silyloxybut-2-en-2-yl]oxolan-2-yl]propanal (PubChem CID 11451492) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is 3-[(2R,4R,5R)-4-methyl-5-[(E)-4-tri(propan-2-yl)silyloxybut-2-en-2-yl]oxolan-2-yl]propanal.
| Compound Name | 3-[(2R,4R,5R)-4-methyl-5-[(E)-4-tri(propan-2-yl)silyloxybut-2-en-2-yl]oxolan-2-yl]propanal |
|---|---|
| PubChem CID | 11451492 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 3-[(2R,4R,5R)-4-methyl-5-[(E)-4-tri(propan-2-yl)silyloxybut-2-en-2-yl]oxolan-2-yl]propanal |
| SMILES | C/C(=C\CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O[C@H](CCC=O)C[C@H]1C |
| InChI | InChI=1S/C21H40O3Si/c1-15(2)25(16(3)4,17(5)6)23-13-11-18(7)21-19(8)14-20(24-21)10-9-12-22/h11-12,15-17,19-21H,9-10,13-14H2,1-8H3/b18-11+/t19-,20-,21+/m1/s1 |
| InChIKey | FBKGPXJXOSDCIF-AMSCELMMSA-N |
| XLogP | 5.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|