C18H29ClN4O2 — CID 11451494
N-[[4-[[amino(cycloheptylcarbamoyl)amino]methyl]phenyl]methyl]acetamide;hydrochloride (PubChem CID 11451494) has the molecular formula C18H29ClN4O2 and a molecular weight of 368.91 g/mol. Its IUPAC name is N-[[4-[[amino(cycloheptylcarbamoyl)amino]methyl]phenyl]methyl]acetamide;hydrochloride.
| Compound Name | N-[[4-[[amino(cycloheptylcarbamoyl)amino]methyl]phenyl]methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 11451494 |
| Molecular Formula | C18H29ClN4O2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-[[4-[[amino(cycloheptylcarbamoyl)amino]methyl]phenyl]methyl]acetamide;hydrochloride |
| SMILES | CC(=O)NCc1ccc(CN(N)C(=O)NC2CCCCCC2)cc1.Cl |
| InChI | InChI=1S/C18H28N4O2.ClH/c1-14(23)20-12-15-8-10-16(11-9-15)13-22(19)18(24)21-17-6-4-2-3-5-7-17;/h8-11,17H,2-7,12-13,19H2,1H3,(H,20,23)(H,21,24);1H |
| InChIKey | HKLAYIHQJWHGSG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|