About 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate
2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate (PubChem CID 11451511) has the molecular formula C23H28FNO2
and a molecular weight of 369.48 g/mol. Its IUPAC name is 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate |
| PubChem CID | 11451511 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate |
| SMILES | CC(C)COC(=O)[C@@H]1CN(Cc2ccccc2)CC[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H28FNO2/c1-17(2)16-27-23(26)22-15-25(14-18-6-4-3-5-7-18)13-12-21(22)19-8-10-20(24)11-9-19/h3-11,17,21-22H,12-16H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | CGEISGJJZDGKSH-FCHUYYIVSA-N |
| XLogP | 4.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate?
The IUPAC name of 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate (CID 11451511) is 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate.
What is the SMILES notation for 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate?
The canonical SMILES for 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate is CC(C)COC(=O)[C@@H]1CN(Cc2ccccc2)CC[C@H]1c1ccc(F)cc1.
What is the InChIKey of 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate?
The InChIKey is CGEISGJJZDGKSH-FCHUYYIVSA-N. The full InChI is InChI=1S/C23H28FNO2/c1-17(2)16-27-23(26)22-15-25(14-18-6-4-3-5-7-18)13-12-21(22)19-8-10-20(24)11-9-19/h3-11,17,21-22H,12-16H2,1-2H3/t21-,22+/m0/s1.
What are the key properties of 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate?
2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate has a molecular weight of 369.48 g/mol, XLogP of 4.63, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl (3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidine-3-carboxylate is sourced from PubChem (CID 11451511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).