C13H24N4 — CID 114515462
2-(1-methylpiperidin-4-yl)-N-(2-pyrazol-1-ylethyl)ethanamine (PubChem CID 114515462) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-(1-methylpiperidin-4-yl)-N-(2-pyrazol-1-ylethyl)ethanamine.
| Compound Name | 2-(1-methylpiperidin-4-yl)-N-(2-pyrazol-1-ylethyl)ethanamine |
|---|---|
| PubChem CID | 114515462 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 2-(1-methylpiperidin-4-yl)-N-(2-pyrazol-1-ylethyl)ethanamine |
| SMILES | CN1CCC(CCNCCn2cccn2)CC1 |
| InChI | InChI=1S/C13H24N4/c1-16-10-4-13(5-11-16)3-7-14-8-12-17-9-2-6-15-17/h2,6,9,13-14H,3-5,7-8,10-12H2,1H3 |
| InChIKey | FSHYLBIYACUIHO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|