C15H23N3S — CID 114515863
2-[2-(1-methylpiperidin-4-yl)ethylamino]benzenecarbothioamide (PubChem CID 114515863) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is 2-[2-(1-methylpiperidin-4-yl)ethylamino]benzenecarbothioamide.
| Compound Name | 2-[2-(1-methylpiperidin-4-yl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114515863 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 2-[2-(1-methylpiperidin-4-yl)ethylamino]benzenecarbothioamide |
| SMILES | CN1CCC(CCNc2ccccc2C(N)=S)CC1 |
| InChI | InChI=1S/C15H23N3S/c1-18-10-7-12(8-11-18)6-9-17-14-5-3-2-4-13(14)15(16)19/h2-5,12,17H,6-11H2,1H3,(H2,16,19) |
| InChIKey | WCVSVTAJYMAVSW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|