C12H18FN3O3 — CID 114517133
5-fluoro-1-[2-(1-methylpiperidin-4-yl)ethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 114517133) has the molecular formula C12H18FN3O3 and a molecular weight of 271.29 g/mol. Its IUPAC name is 5-fluoro-1-[2-(1-methylpiperidin-4-yl)ethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-fluoro-1-[2-(1-methylpiperidin-4-yl)ethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 114517133 |
| Molecular Formula | C12H18FN3O3 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 5-fluoro-1-[2-(1-methylpiperidin-4-yl)ethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1CCC(CCN2C(=O)NC(=O)C(F)C2=O)CC1 |
| InChI | InChI=1S/C12H18FN3O3/c1-15-5-2-8(3-6-15)4-7-16-11(18)9(13)10(17)14-12(16)19/h8-9H,2-7H2,1H3,(H,14,17,19) |
| InChIKey | VUODGZYODWPCTD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|