C10H7BrO4 — CID 114517204
6-bromo-1-oxo-3,4-dihydroisochromene-3-carboxylic acid (PubChem CID 114517204) has the molecular formula C10H7BrO4 and a molecular weight of 271.07 g/mol. Its IUPAC name is 6-bromo-1-oxo-3,4-dihydroisochromene-3-carboxylic acid.
| Compound Name | 6-bromo-1-oxo-3,4-dihydroisochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 114517204 |
| Molecular Formula | C10H7BrO4 |
| Molecular Weight | 271.07 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | 6-bromo-1-oxo-3,4-dihydroisochromene-3-carboxylic acid |
| SMILES | O=C1OC(C(=O)O)Cc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H7BrO4/c11-6-1-2-7-5(3-6)4-8(9(12)13)15-10(7)14/h1-3,8H,4H2,(H,12,13) |
| InChIKey | NNLQPEXTPVCBEX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.07 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |