C17H16BrN3 — CID 11451768
6-bromo-N-pyridin-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 11451768) has the molecular formula C17H16BrN3 and a molecular weight of 342.24 g/mol. Its IUPAC name is 6-bromo-N-pyridin-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | 6-bromo-N-pyridin-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 11451768 |
| Molecular Formula | C17H16BrN3 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 6-bromo-N-pyridin-2-yl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | Brc1ccc2[nH]c3c(c2c1)CCCC3Nc1ccccn1 |
| InChI | InChI=1S/C17H16BrN3/c18-11-7-8-14-13(10-11)12-4-3-5-15(17(12)21-14)20-16-6-1-2-9-19-16/h1-2,6-10,15,21H,3-5H2,(H,19,20) |
| InChIKey | AXSGAGOQUCLGNJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|