C19H29NO2Se — CID 11451863
(1R)-1-[2-[[(5S,6R)-1,7-dioxaspiro[5.5]undecan-5-yl]selanyl]phenyl]-N,N-dimethylethanamine (PubChem CID 11451863) has the molecular formula C19H29NO2Se and a molecular weight of 382.41 g/mol. Its IUPAC name is (1R)-1-[2-[[(5S,6R)-1,7-dioxaspiro[5.5]undecan-5-yl]selanyl]phenyl]-N,N-dimethylethanamine.
| Compound Name | (1R)-1-[2-[[(5S,6R)-1,7-dioxaspiro[5.5]undecan-5-yl]selanyl]phenyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 11451863 |
| Molecular Formula | C19H29NO2Se |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (1R)-1-[2-[[(5S,6R)-1,7-dioxaspiro[5.5]undecan-5-yl]selanyl]phenyl]-N,N-dimethylethanamine |
| SMILES | C[C@H](c1ccccc1[Se][C@H]1CCCO[C@]12CCCCO2)N(C)C |
| InChI | InChI=1S/C19H29NO2Se/c1-15(20(2)3)16-9-4-5-10-17(16)23-18-11-8-14-22-19(18)12-6-7-13-21-19/h4-5,9-10,15,18H,6-8,11-14H2,1-3H3/t15-,18+,19-/m1/s1 |
| InChIKey | SYBSBRGJSTYIDF-AYOQOUSVSA-N |
| XLogP | 3.13 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|