C14H15BrN2O — CID 114522016
2-[(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 114522016) has the molecular formula C14H15BrN2O and a molecular weight of 307.19 g/mol. Its IUPAC name is 2-[(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-[(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 114522016 |
| Molecular Formula | C14H15BrN2O |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-[(5-bromofuran-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | Nc1cccc2c1CN(Cc1ccc(Br)o1)CC2 |
| InChI | InChI=1S/C14H15BrN2O/c15-14-5-4-11(18-14)8-17-7-6-10-2-1-3-13(16)12(10)9-17/h1-5H,6-9,16H2 |
| InChIKey | HKBSDSQKPRVZSX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|