C19H27NO — CID 114523573
N-[[2-(3-cyclopropyloxyphenyl)cyclohexyl]methyl]cyclopropanamine (PubChem CID 114523573) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is N-[[2-(3-cyclopropyloxyphenyl)cyclohexyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(3-cyclopropyloxyphenyl)cyclohexyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114523573 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-[[2-(3-cyclopropyloxyphenyl)cyclohexyl]methyl]cyclopropanamine |
| SMILES | c1cc(OC2CC2)cc(C2CCCCC2CNC2CC2)c1 |
| InChI | InChI=1S/C19H27NO/c1-2-7-19(15(4-1)13-20-16-8-9-16)14-5-3-6-18(12-14)21-17-10-11-17/h3,5-6,12,15-17,19-20H,1-2,4,7-11,13H2 |
| InChIKey | SNTQGZSXRASADX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |