About 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid
5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 114524115) has the molecular formula C15H18N4O2
and a molecular weight of 286.34 g/mol. Its IUPAC name is 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid |
| PubChem CID | 114524115 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | Cn1ncc(C(=O)O)c1CN1CCc2cccc(N)c2C1 |
| InChI | InChI=1S/C15H18N4O2/c1-18-14(11(7-17-18)15(20)21)9-19-6-5-10-3-2-4-13(16)12(10)8-19/h2-4,7H,5-6,8-9,16H2,1H3,(H,20,21) |
| InChIKey | FQDPWFGDUZQRQH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid?
The IUPAC name of 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid (CID 114524115) is 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid.
What is the SMILES notation for 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid?
The canonical SMILES for 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid is Cn1ncc(C(=O)O)c1CN1CCc2cccc(N)c2C1.
What is the InChIKey of 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid?
The InChIKey is FQDPWFGDUZQRQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2/c1-18-14(11(7-17-18)15(20)21)9-19-6-5-10-3-2-4-13(16)12(10)8-19/h2-4,7H,5-6,8-9,16H2,1H3,(H,20,21).
What are the key properties of 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid?
5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid has a molecular weight of 286.34 g/mol, XLogP of 1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid is sourced from PubChem (CID 114524115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).