C21H46O3Si2 — CID 11452418
(3S,6S)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyloctan-2-one (PubChem CID 11452418) has the molecular formula C21H46O3Si2 and a molecular weight of 402.77 g/mol. Its IUPAC name is (3S,6S)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyloctan-2-one.
| Compound Name | (3S,6S)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyloctan-2-one |
|---|---|
| PubChem CID | 11452418 |
| Molecular Formula | C21H46O3Si2 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (3S,6S)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyloctan-2-one |
| SMILES | CC(=O)[C@@H](C)CC[C@@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H46O3Si2/c1-17(18(2)22)13-14-19(24-26(11,12)21(6,7)8)15-16-23-25(9,10)20(3,4)5/h17,19H,13-16H2,1-12H3/t17-,19-/m0/s1 |
| InChIKey | SMMFOVMSZCTUJD-HKUYNNGSSA-N |
| XLogP | 6.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|