C15H25BrN2O — CID 114524882
3-[4-bromo-3-[(propan-2-ylamino)methyl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 114524882) has the molecular formula C15H25BrN2O and a molecular weight of 329.28 g/mol. Its IUPAC name is 3-[4-bromo-3-[(propan-2-ylamino)methyl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-bromo-3-[(propan-2-ylamino)methyl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 114524882 |
| Molecular Formula | C15H25BrN2O |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 3-[4-bromo-3-[(propan-2-ylamino)methyl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CC(C)NCc1cc(OCCCN(C)C)ccc1Br |
| InChI | InChI=1S/C15H25BrN2O/c1-12(2)17-11-13-10-14(6-7-15(13)16)19-9-5-8-18(3)4/h6-7,10,12,17H,5,8-9,11H2,1-4H3 |
| InChIKey | FZBLCUKGTRWOSO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|