C13H18N2S — CID 114525182
N-(1-benzothiophen-5-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 114525182) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is N-(1-benzothiophen-5-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(1-benzothiophen-5-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 114525182 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-(1-benzothiophen-5-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1ccc2sccc2c1 |
| InChI | InChI=1S/C13H18N2S/c1-15(2)8-3-7-14-12-4-5-13-11(10-12)6-9-16-13/h4-6,9-10,14H,3,7-8H2,1-2H3 |
| InChIKey | FFCSMDWOPFFEEC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|