About 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide
2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide (PubChem CID 11452552) has the molecular formula C13H20Br2N4O
and a molecular weight of 408.14 g/mol. Its IUPAC name is 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide.
Molecular Properties
| Compound Name | 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide |
| PubChem CID | 11452552 |
| Molecular Formula | C13H20Br2N4O |
| Molecular Weight | 408.14 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide |
| SMILES | Br.Br.CCCN1CCN(c2nc3ncccc3o2)CC1 |
| InChI | InChI=1S/C13H18N4O.2BrH/c1-2-6-16-7-9-17(10-8-16)13-15-12-11(18-13)4-3-5-14-12;;/h3-5H,2,6-10H2,1H3;2*1H |
| InChIKey | BUZDUOMPXVAGJC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.14 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide?
The IUPAC name of 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide (CID 11452552) is 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide.
What is the SMILES notation for 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide?
The canonical SMILES for 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide is Br.Br.CCCN1CCN(c2nc3ncccc3o2)CC1.
What is the InChIKey of 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide?
The InChIKey is BUZDUOMPXVAGJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O.2BrH/c1-2-6-16-7-9-17(10-8-16)13-15-12-11(18-13)4-3-5-14-12;;/h3-5H,2,6-10H2,1H3;2*1H.
What are the key properties of 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide?
2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide has a molecular weight of 408.14 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-propylpiperazin-1-yl)-[1,3]oxazolo[4,5-b]pyridine;dihydrobromide is sourced from PubChem (CID 11452552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).