About 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine
5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine (PubChem CID 114525530) has the molecular formula C10H21N5S
and a molecular weight of 243.38 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine |
| PubChem CID | 114525530 |
| Molecular Formula | C10H21N5S |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine |
| SMILES | CC(C)n1c(N)nnc1SCCCN(C)C |
| InChI | InChI=1S/C10H21N5S/c1-8(2)15-9(11)12-13-10(15)16-7-5-6-14(3)4/h8H,5-7H2,1-4H3,(H2,11,12) |
| InChIKey | CIVOFMOHWCBOIX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine?
The IUPAC name of 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine (CID 114525530) is 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine?
The canonical SMILES for 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine is CC(C)n1c(N)nnc1SCCCN(C)C.
What is the InChIKey of 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine?
The InChIKey is CIVOFMOHWCBOIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N5S/c1-8(2)15-9(11)12-13-10(15)16-7-5-6-14(3)4/h8H,5-7H2,1-4H3,(H2,11,12).
What are the key properties of 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine?
5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine has a molecular weight of 243.38 g/mol, XLogP of 1.49, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(dimethylamino)propylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine is sourced from PubChem (CID 114525530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).