C28H40O2 — CID 11452572
(3R,8R,9S,10S,13S,14S)-3-methoxy-10,13-dimethyl-3-(2-phenylethyl)-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 11452572) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is (3R,8R,9S,10S,13S,14S)-3-methoxy-10,13-dimethyl-3-(2-phenylethyl)-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,8R,9S,10S,13S,14S)-3-methoxy-10,13-dimethyl-3-(2-phenylethyl)-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11452572 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | (3R,8R,9S,10S,13S,14S)-3-methoxy-10,13-dimethyl-3-(2-phenylethyl)-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CO[C@]1(CCc2ccccc2)CC[C@@]2(C)C(CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H40O2/c1-26-17-18-28(30-3,16-13-20-7-5-4-6-8-20)19-21(26)9-10-22-23-11-12-25(29)27(23,2)15-14-24(22)26/h4-8,21-24H,9-19H2,1-3H3/t21?,22-,23-,24-,26-,27-,28+/m0/s1 |
| InChIKey | GCBCNNNYHZBPGK-BDVLNOFUSA-N |
| XLogP | 6.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |