C13H19NO5S — CID 114525746
5-[3-(dimethylamino)propylsulfonyl]-2-methoxybenzoic acid (PubChem CID 114525746) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propylsulfonyl]-2-methoxybenzoic acid.
| Compound Name | 5-[3-(dimethylamino)propylsulfonyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 114525746 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 5-[3-(dimethylamino)propylsulfonyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)CCCN(C)C)cc1C(=O)O |
| InChI | InChI=1S/C13H19NO5S/c1-14(2)7-4-8-20(17,18)10-5-6-12(19-3)11(9-10)13(15)16/h5-6,9H,4,7-8H2,1-3H3,(H,15,16) |
| InChIKey | UHLRFMDNFWVLPG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |