About 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane
2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane (PubChem CID 11452616) has the molecular formula C29H34Si
and a molecular weight of 410.68 g/mol. Its IUPAC name is 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane |
| PubChem CID | 11452616 |
| Molecular Formula | C29H34Si |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1ccc(C#CC2=CCCc3ccccc32)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H34Si/c1-22(2)30(23(3)4,24(5)6)21-20-26-16-14-25(15-17-26)18-19-28-12-9-11-27-10-7-8-13-29(27)28/h7-8,10,12-17,22-24H,9,11H2,1-6H3 |
| InChIKey | YJARXUQCGDGGQG-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane?
The IUPAC name of 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane (CID 11452616) is 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane.
What is the SMILES notation for 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane?
The canonical SMILES for 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane is CC(C)[Si](C#Cc1ccc(C#CC2=CCCc3ccccc32)cc1)(C(C)C)C(C)C.
What is the InChIKey of 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane?
The InChIKey is YJARXUQCGDGGQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H34Si/c1-22(2)30(23(3)4,24(5)6)21-20-26-16-14-25(15-17-26)18-19-28-12-9-11-27-10-7-8-13-29(27)28/h7-8,10,12-17,22-24H,9,11H2,1-6H3.
What are the key properties of 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane?
2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane has a molecular weight of 410.68 g/mol, XLogP of 7.64, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(3,4-dihydronaphthalen-1-yl)ethynyl]phenyl]ethynyl-tri(propan-2-yl)silane is sourced from PubChem (CID 11452616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).