C17H29N3O — CID 114526504
1-[2-[3-(dimethylamino)propoxy]-5-methylphenyl]piperidin-3-amine (PubChem CID 114526504) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-[2-[3-(dimethylamino)propoxy]-5-methylphenyl]piperidin-3-amine.
| Compound Name | 1-[2-[3-(dimethylamino)propoxy]-5-methylphenyl]piperidin-3-amine |
|---|---|
| PubChem CID | 114526504 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 1-[2-[3-(dimethylamino)propoxy]-5-methylphenyl]piperidin-3-amine |
| SMILES | Cc1ccc(OCCCN(C)C)c(N2CCCC(N)C2)c1 |
| InChI | InChI=1S/C17H29N3O/c1-14-7-8-17(21-11-5-9-19(2)3)16(12-14)20-10-4-6-15(18)13-20/h7-8,12,15H,4-6,9-11,13,18H2,1-3H3 |
| InChIKey | YAQSXVPQEYTRBC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|