C12H25BrN2 — CID 114526692
3-[2-(3-bromopropyl)pyrrolidin-1-yl]-N,N-dimethylpropan-1-amine (PubChem CID 114526692) has the molecular formula C12H25BrN2 and a molecular weight of 277.25 g/mol. Its IUPAC name is 3-[2-(3-bromopropyl)pyrrolidin-1-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[2-(3-bromopropyl)pyrrolidin-1-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 114526692 |
| Molecular Formula | C12H25BrN2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-[2-(3-bromopropyl)pyrrolidin-1-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCN1CCCC1CCCBr |
| InChI | InChI=1S/C12H25BrN2/c1-14(2)9-5-11-15-10-4-7-12(15)6-3-8-13/h12H,3-11H2,1-2H3 |
| InChIKey | SWJBRCNHISSRMG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|