C12H26N6S — CID 114526814
N-[2-[5-[3-(dimethylamino)propylsulfanyl]tetrazol-1-yl]ethyl]-2-methylpropan-1-amine (PubChem CID 114526814) has the molecular formula C12H26N6S and a molecular weight of 286.45 g/mol. Its IUPAC name is N-[2-[5-[3-(dimethylamino)propylsulfanyl]tetrazol-1-yl]ethyl]-2-methylpropan-1-amine.
| Compound Name | N-[2-[5-[3-(dimethylamino)propylsulfanyl]tetrazol-1-yl]ethyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 114526814 |
| Molecular Formula | C12H26N6S |
| Molecular Weight | 286.45 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | N-[2-[5-[3-(dimethylamino)propylsulfanyl]tetrazol-1-yl]ethyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCCn1nnnc1SCCCN(C)C |
| InChI | InChI=1S/C12H26N6S/c1-11(2)10-13-6-8-18-12(14-15-16-18)19-9-5-7-17(3)4/h11,13H,5-10H2,1-4H3 |
| InChIKey | MROMZMZKULHPFP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.45 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|