C21H21FN2O4S — CID 11452761
2-[6-[(4-fluorophenyl)sulfonylamino]-3-methyl-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 11452761) has the molecular formula C21H21FN2O4S and a molecular weight of 416.47 g/mol. Its IUPAC name is 2-[6-[(4-fluorophenyl)sulfonylamino]-3-methyl-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[6-[(4-fluorophenyl)sulfonylamino]-3-methyl-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 11452761 |
| Molecular Formula | C21H21FN2O4S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-[6-[(4-fluorophenyl)sulfonylamino]-3-methyl-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | CC1CCc2c(c3cc(NS(=O)(=O)c4ccc(F)cc4)ccc3n2CC(=O)O)C1 |
| InChI | InChI=1S/C21H21FN2O4S/c1-13-2-8-19-17(10-13)18-11-15(5-9-20(18)24(19)12-21(25)26)23-29(27,28)16-6-3-14(22)4-7-16/h3-7,9,11,13,23H,2,8,10,12H2,1H3,(H,25,26) |
| InChIKey | PTWZVTYHJNTFCV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|