C21H41ClO2Si2 — CID 11452789
tert-butyl-[(1R,3S,5Z)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloroethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane (PubChem CID 11452789) has the molecular formula C21H41ClO2Si2 and a molecular weight of 417.18 g/mol. Its IUPAC name is tert-butyl-[(1R,3S,5Z)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloroethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,3S,5Z)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloroethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11452789 |
| Molecular Formula | C21H41ClO2Si2 |
| Molecular Weight | 417.18 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | tert-butyl-[(1R,3S,5Z)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloroethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane |
| SMILES | C=C1/C(=C\CCl)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H41ClO2Si2/c1-16-17(12-13-22)14-18(23-25(8,9)20(2,3)4)15-19(16)24-26(10,11)21(5,6)7/h12,18-19H,1,13-15H2,2-11H3/b17-12-/t18-,19+/m1/s1 |
| InChIKey | LMDOYFASUNIFPL-AIZSWXQMSA-N |
| XLogP | 7.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.18 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|