C24H46O4Si — CID 11453081
2-[(2R,3S,6S,8S)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethanol (PubChem CID 11453081) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is 2-[(2R,3S,6S,8S)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethanol.
| Compound Name | 2-[(2R,3S,6S,8S)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethanol |
|---|---|
| PubChem CID | 11453081 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | 2-[(2R,3S,6S,8S)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethanol |
| SMILES | CC(C)[Si](OCCC[C@H]1O[C@]2(C=C[C@@H]1C)CCC[C@@H](CCO)O2)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H46O4Si/c1-18(2)29(19(3)4,20(5)6)26-17-9-11-23-21(7)12-15-24(28-23)14-8-10-22(27-24)13-16-25/h12,15,18-23,25H,8-11,13-14,16-17H2,1-7H3/t21-,22-,23+,24-/m0/s1 |
| InChIKey | BXDWJSPFCUYNJW-XQUALCHDSA-N |
| XLogP | 6.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|