C25H50O3Si — CID 11453082
methyl (E,6S,7S,10S,12R)-7-[tert-butyl(dimethyl)silyl]oxy-6,8,10,12-tetramethyltetradec-8-enoate (PubChem CID 11453082) has the molecular formula C25H50O3Si and a molecular weight of 426.76 g/mol. Its IUPAC name is methyl (E,6S,7S,10S,12R)-7-[tert-butyl(dimethyl)silyl]oxy-6,8,10,12-tetramethyltetradec-8-enoate.
| Compound Name | methyl (E,6S,7S,10S,12R)-7-[tert-butyl(dimethyl)silyl]oxy-6,8,10,12-tetramethyltetradec-8-enoate |
|---|---|
| PubChem CID | 11453082 |
| Molecular Formula | C25H50O3Si |
| Molecular Weight | 426.76 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | methyl (E,6S,7S,10S,12R)-7-[tert-butyl(dimethyl)silyl]oxy-6,8,10,12-tetramethyltetradec-8-enoate |
| SMILES | CC[C@@H](C)C[C@H](C)/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCCCC(=O)OC |
| InChI | InChI=1S/C25H50O3Si/c1-12-19(2)17-20(3)18-22(5)24(28-29(10,11)25(6,7)8)21(4)15-13-14-16-23(26)27-9/h18-21,24H,12-17H2,1-11H3/b22-18+/t19-,20+,21+,24+/m1/s1 |
| InChIKey | VRADUVLIIJDOQP-NTXRCTLHSA-N |
| XLogP | 7.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.76 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|