C22H40O6Si — CID 11453138
[(E,4R)-4-[(2R,4R)-4-methoxy-6-oxooxan-2-yl]-2-methyl-4-tri(propan-2-yl)silyloxybut-2-enyl] acetate (PubChem CID 11453138) has the molecular formula C22H40O6Si and a molecular weight of 428.64 g/mol. Its IUPAC name is [(E,4R)-4-[(2R,4R)-4-methoxy-6-oxooxan-2-yl]-2-methyl-4-tri(propan-2-yl)silyloxybut-2-enyl] acetate.
| Compound Name | [(E,4R)-4-[(2R,4R)-4-methoxy-6-oxooxan-2-yl]-2-methyl-4-tri(propan-2-yl)silyloxybut-2-enyl] acetate |
|---|---|
| PubChem CID | 11453138 |
| Molecular Formula | C22H40O6Si |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | [(E,4R)-4-[(2R,4R)-4-methoxy-6-oxooxan-2-yl]-2-methyl-4-tri(propan-2-yl)silyloxybut-2-enyl] acetate |
| SMILES | CO[C@H]1CC(=O)O[C@@H]([C@@H](/C=C(\C)COC(C)=O)O[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C22H40O6Si/c1-14(2)29(15(3)4,16(5)6)28-21(10-17(7)13-26-18(8)23)20-11-19(25-9)12-22(24)27-20/h10,14-16,19-21H,11-13H2,1-9H3/b17-10+/t19-,20-,21-/m1/s1 |
| InChIKey | KIYOSDDKFZZFBN-MHXQTTRBSA-N |
| XLogP | 4.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|