C12H20ClN3 — CID 114531735
4-(chloromethyl)-1-[2-(1-methylimidazol-2-yl)ethyl]piperidine (PubChem CID 114531735) has the molecular formula C12H20ClN3 and a molecular weight of 241.77 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[2-(1-methylimidazol-2-yl)ethyl]piperidine.
| Compound Name | 4-(chloromethyl)-1-[2-(1-methylimidazol-2-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 114531735 |
| Molecular Formula | C12H20ClN3 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-(chloromethyl)-1-[2-(1-methylimidazol-2-yl)ethyl]piperidine |
| SMILES | Cn1ccnc1CCN1CCC(CCl)CC1 |
| InChI | InChI=1S/C12H20ClN3/c1-15-9-5-14-12(15)4-8-16-6-2-11(10-13)3-7-16/h5,9,11H,2-4,6-8,10H2,1H3 |
| InChIKey | SZUNPMWDPVOLKX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|