C14H25N3O — CID 114532898
(Z)-N-(2-methoxyethyl)-4-methyl-6-(1-methylimidazol-2-yl)hex-3-en-1-amine (PubChem CID 114532898) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is (Z)-N-(2-methoxyethyl)-4-methyl-6-(1-methylimidazol-2-yl)hex-3-en-1-amine.
| Compound Name | (Z)-N-(2-methoxyethyl)-4-methyl-6-(1-methylimidazol-2-yl)hex-3-en-1-amine |
|---|---|
| PubChem CID | 114532898 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | (Z)-N-(2-methoxyethyl)-4-methyl-6-(1-methylimidazol-2-yl)hex-3-en-1-amine |
| SMILES | COCCNCC/C=C(/C)CCc1nccn1C |
| InChI | InChI=1S/C14H25N3O/c1-13(5-4-8-15-10-12-18-3)6-7-14-16-9-11-17(14)2/h5,9,11,15H,4,6-8,10,12H2,1-3H3/b13-5- |
| InChIKey | XOROVKOULZRYSK-ACAGNQJTSA-N |
| XLogP | 1.93 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|