3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid

C10H16O5S — CID 114533846

IUPAC3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid
SMILESCC1OCCC1(C(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C10H16O5S/c1-7-10(9(11)12,3-4-15-7)8-2-5-16(13,14)6-8/h7-8H,2-6H2,1H3,(H,11,12)
InChIKeyOGWBLOZRWTYNTP-UHFFFAOYSA-N
MW248.30 g/mol
LogP0.30
Rot. Bonds2

About 3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid

3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid (PubChem CID 114533846) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid.

Molecular Properties

Compound Name3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid
PubChem CID114533846
Molecular FormulaC10H16O5S
Molecular Weight248.30 g/mol
Exact Mass248.07
IUPAC Name3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid
SMILESCC1OCCC1(C(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C10H16O5S/c1-7-10(9(11)12,3-4-15-7)8-2-5-16(13,14)6-8/h7-8H,2-6H2,1H3,(H,11,12)
InChIKeyOGWBLOZRWTYNTP-UHFFFAOYSA-N
XLogP0.30
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.30
LogP ≤ 50.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid?
The IUPAC name of 3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid (CID 114533846) is 3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid.
What is the SMILES notation for 3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid?
The canonical SMILES for 3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid is CC1OCCC1(C(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid?
The InChIKey is OGWBLOZRWTYNTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5S/c1-7-10(9(11)12,3-4-15-7)8-2-5-16(13,14)6-8/h7-8H,2-6H2,1H3,(H,11,12).
What are the key properties of 3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid?
3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid has a molecular weight of 248.30 g/mol, XLogP of 0.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothiolan-3-yl)-2-methyloxolane-3-carboxylic acid is sourced from PubChem (CID 114533846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).