C27H23N3O3 — CID 11453400
6-[2-(dimethylamino)ethoxy]-13-methyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4(9),5,7,11(15),16,18,20,22-decaene-12,14-dione (PubChem CID 11453400) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethoxy]-13-methyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4(9),5,7,11(15),16,18,20,22-decaene-12,14-dione.
| Compound Name | 6-[2-(dimethylamino)ethoxy]-13-methyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4(9),5,7,11(15),16,18,20,22-decaene-12,14-dione |
|---|---|
| PubChem CID | 11453400 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 6-[2-(dimethylamino)ethoxy]-13-methyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4(9),5,7,11(15),16,18,20,22-decaene-12,14-dione |
| SMILES | CN(C)CCOc1ccc2c(c1)[nH]c1c3cc4ccccc4cc3c3c(c21)C(=O)N(C)C3=O |
| InChI | InChI=1S/C27H23N3O3/c1-29(2)10-11-33-17-8-9-18-21(14-17)28-25-20-13-16-7-5-4-6-15(16)12-19(20)23-24(22(18)25)27(32)30(3)26(23)31/h4-9,12-14,28H,10-11H2,1-3H3 |
| InChIKey | RMCMNPCTNMIDKA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|