About N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine
N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine (PubChem CID 114534364) has the molecular formula C15H21Cl2NO
and a molecular weight of 302.24 g/mol. Its IUPAC name is N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine |
| PubChem CID | 114534364 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine |
| SMILES | CCNCC1(Cc2c(Cl)cccc2Cl)CCOC1C |
| InChI | InChI=1S/C15H21Cl2NO/c1-3-18-10-15(7-8-19-11(15)2)9-12-13(16)5-4-6-14(12)17/h4-6,11,18H,3,7-10H2,1-2H3 |
| InChIKey | NWMUPBKOVKOLCD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine?
The IUPAC name of N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine (CID 114534364) is N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine.
What is the SMILES notation for N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine?
The canonical SMILES for N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine is CCNCC1(Cc2c(Cl)cccc2Cl)CCOC1C.
What is the InChIKey of N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine?
The InChIKey is NWMUPBKOVKOLCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Cl2NO/c1-3-18-10-15(7-8-19-11(15)2)9-12-13(16)5-4-6-14(12)17/h4-6,11,18H,3,7-10H2,1-2H3.
What are the key properties of N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine?
N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine has a molecular weight of 302.24 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-[(2,6-dichlorophenyl)methyl]-2-methyloxolan-3-yl]methyl]ethanamine is sourced from PubChem (CID 114534364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).